CAS 1206694-75-8 is the registry number for (E)-N-(4-(Benzyloxy)benzylidene)-4-fluoroaniline, 97%. Offered by: AmBeed. Available pack sizes: 5g, 25g.
N-(4-fluorophenyl)-1-(4-phenylmethoxyphenyl)methanimine (CAS 1206694-75-8) is a chemical compound with the molecular formula C20H16FNO and a molecular weight of 305.3 g/mol. IUPAC name: N-(4-fluorophenyl)-1-(4-phenylmethoxyphenyl)methanimine. InChIKey: IWNBEFDVKWCBFY-UHFFFAOYSA-N.
| Molecular formula | C20H16FNO |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | N-(4-fluorophenyl)-1-(4-phenylmethoxyphenyl)methanimine |
| InChIKey | IWNBEFDVKWCBFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C=NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)