CAS 1206824-89-6 appears in our catalog under these names: tert-Butyl methyl((3r,4r)-4-methylpiperidin-3-yl)carbamate, 95%, (3R,4R)-3-(N-BOC-N-methylamino)-4-methylpiperidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g, 50mg.
Tert-butyl N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate (CAS 1206824-89-6) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate. InChIKey: GEUGTHQTDCPAHY-ZJUUUORDSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate |
| InChIKey | GEUGTHQTDCPAHY-ZJUUUORDSA-N |
| SMILES | C[C@@H]1CCNC[C@@H]1N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)