Products 120688-08-6
CAS 120688-08-6 is the registry number for Risotilide. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(methanesulfonamido)-N-propan-2-yl-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide (CAS 120688-08-6) is a chemical compound with the molecular formula C15H27N3O4S2 and a molecular weight of 377.5 g/mol. IUPAC name: 4-(methanesulfonamido)-N-propan-2-yl-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide. InChIKey: GLIRXHQYWRYQDV-UHFFFAOYSA-N.
| Molecular formula | C15H27N3O4S2 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 4-(methanesulfonamido)-N-propan-2-yl-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide |
| InChIKey | GLIRXHQYWRYQDV-UHFFFAOYSA-N |
| SMILES | CC(C)NCCN(C(C)C)S(=O)(=O)C1=CC=C(C=C1)NS(=O)(=O)C |
Computed by PubChem (NCBI)