CAS 120692-81-1 is the registry number for 1-Azido-2-(chloromethyl)benzene. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-azido-2-(chloromethyl)benzene (CAS 120692-81-1) is a chemical compound with the molecular formula C7H6ClN3 and a molecular weight of 167.59 g/mol. IUPAC name: 1-azido-2-(chloromethyl)benzene. InChIKey: MOVOUDHUOLTHAC-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3 |
|---|---|
| Molecular weight | 167.59 g/mol |
| IUPAC name | 1-azido-2-(chloromethyl)benzene |
| InChIKey | MOVOUDHUOLTHAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)N=[N+]=[N-] |
Computed by PubChem (NCBI)