Products 1206969-79-0
CAS 1206969-79-0 is the registry number for 5-(4-(1,3-Dioxan-2-yl)-3-fluorophenyl)-2-chloropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
2-chloro-5-[4-(1,3-dioxan-2-yl)-3-fluorophenyl]pyridine (CAS 1206969-79-0) is a chemical compound with the molecular formula C15H13ClFNO2 and a molecular weight of 293.72 g/mol. IUPAC name: 2-chloro-5-[4-(1,3-dioxan-2-yl)-3-fluorophenyl]pyridine. InChIKey: QLSAVFDATCSIAX-UHFFFAOYSA-N.
| Molecular formula | C15H13ClFNO2 |
|---|---|
| Molecular weight | 293.72 g/mol |
| IUPAC name | 2-chloro-5-[4-(1,3-dioxan-2-yl)-3-fluorophenyl]pyridine |
| InChIKey | QLSAVFDATCSIAX-UHFFFAOYSA-N |
| SMILES | C1COC(OC1)C2=C(C=C(C=C2)C3=CN=C(C=C3)Cl)F |
Computed by PubChem (NCBI)