CAS 1206970-13-9 is the registry number for N-(4-(3-Chloropyrazin-2-yloxy)phenyl)pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[4-(3-chloropyrazin-2-yl)oxyphenyl]pyridin-2-amine (CAS 1206970-13-9) is a chemical compound with the molecular formula C15H11ClN4O and a molecular weight of 298.73 g/mol. IUPAC name: N-[4-(3-chloropyrazin-2-yl)oxyphenyl]pyridin-2-amine. InChIKey: LDYLVUWDLXEWSK-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN4O |
|---|---|
| Molecular weight | 298.73 g/mol |
| IUPAC name | N-[4-(3-chloropyrazin-2-yl)oxyphenyl]pyridin-2-amine |
| InChIKey | LDYLVUWDLXEWSK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC2=CC=C(C=C2)OC3=NC=CN=C3Cl |
Computed by PubChem (NCBI)