CAS 1206970-29-7 is the registry number for 2-(2-(4-(Trifluoromethyl)-2-oxopyrimidin-1(2h)-yl)ethyl)isoindoline-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[2-[2-oxo-4-(trifluoromethyl)pyrimidin-1-yl]ethyl]isoindole-1,3-dione (CAS 1206970-29-7) is a chemical compound with the molecular formula C15H10F3N3O3 and a molecular weight of 337.25 g/mol. IUPAC name: 2-[2-[2-oxo-4-(trifluoromethyl)pyrimidin-1-yl]ethyl]isoindole-1,3-dione. InChIKey: SHYWHSOIKYIVQB-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N3O3 |
|---|---|
| Molecular weight | 337.25 g/mol |
| IUPAC name | 2-[2-[2-oxo-4-(trifluoromethyl)pyrimidin-1-yl]ethyl]isoindole-1,3-dione |
| InChIKey | SHYWHSOIKYIVQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCN3C=CC(=NC3=O)C(F)(F)F |
Computed by PubChem (NCBI)