CAS 1206970-49-1 is the registry number for tert-Butyl 3-(3-(bromomethylene)cyclobutyl)azetidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
Tert-butyl 3-[3-(bromomethylidene)cyclobutyl]azetidine-1-carboxylate (CAS 1206970-49-1) is a chemical compound with the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. IUPAC name: tert-butyl 3-[3-(bromomethylidene)cyclobutyl]azetidine-1-carboxylate. InChIKey: BOMUMBHUFIQUDC-UHFFFAOYSA-N.
| Molecular formula | C13H20BrNO2 |
|---|---|
| Molecular weight | 302.21 g/mol |
| IUPAC name | tert-butyl 3-[3-(bromomethylidene)cyclobutyl]azetidine-1-carboxylate |
| InChIKey | BOMUMBHUFIQUDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2CC(=CBr)C2 |
Computed by PubChem (NCBI)