CAS 1206970-67-3 is the registry number for 3-(3,3-Dimethylbutanamido)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(3,3-dimethylbutanoylamino)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 1206970-67-3) is a chemical compound with the molecular formula C13H16N4O3 and a molecular weight of 276.29 g/mol. IUPAC name: 3-(3,3-dimethylbutanoylamino)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: RZCDHYYJVSZWDI-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O3 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 3-(3,3-dimethylbutanoylamino)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | RZCDHYYJVSZWDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NC1=NN=C2N1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)