Products 1207175-68-5
CAS 1207175-68-5 appears in our catalog under these names: 7-Bromo-3,4-dihydroquinazolin-2(1H)-one, 98%, 7-Bromo-3,4-dihydroquinazolin-2(1H)-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g, 0,5g.
7-bromo-3,4-dihydro-1H-quinazolin-2-one (CAS 1207175-68-5) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 7-bromo-3,4-dihydro-1H-quinazolin-2-one. InChIKey: BPYIKIULEAEKEE-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-1H-quinazolin-2-one |
| InChIKey | BPYIKIULEAEKEE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)Br)NC(=O)N1 |
Computed by PubChem (NCBI)