Products 1207326-95-1

CAS 1207326-95-1 is the registry number for 4-([(Dimethylsulfamoyl)(2-fluorophenyl)amino]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzoic acid (CAS 1207326-95-1) is a chemical compound with the molecular formula C16H17FN2O4S and a molecular weight of 352.4 g/mol. IUPAC name: 4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzoic acid. InChIKey: OPMAUISNYFULSM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17FN2O4S
Molecular weight352.4 g/mol
IUPAC name4-[[N-(dimethylsulfamoyl)-2-fluoroanilino]methyl]benzoic acid
InChIKeyOPMAUISNYFULSM-UHFFFAOYSA-N
SMILESCN(C)S(=O)(=O)N(CC1=CC=C(C=C1)C(=O)O)C2=CC=CC=C2F

Computed by PubChem (NCBI)