CAS 1207440-88-7 is the registry number for ADX71441, 98.63%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 100 mg, 50 mg.
N-[5-[4-[(4-chloro-3-fluorophenyl)methyl]-6-methoxy-3,5-dioxo-1,2,4-triazin-2-yl]-2-fluorophenyl]acetamide (CAS 1207440-88-7) is a chemical compound with the molecular formula C19H15ClF2N4O4 and a molecular weight of 436.8 g/mol. IUPAC name: N-[5-[4-[(4-chloro-3-fluorophenyl)methyl]-6-methoxy-3,5-dioxo-1,2,4-triazin-2-yl]-2-fluorophenyl]acetamide. InChIKey: BQDMEJYNGXEHSW-UHFFFAOYSA-N.
| Molecular formula | C19H15ClF2N4O4 |
|---|---|
| Molecular weight | 436.8 g/mol |
| IUPAC name | N-[5-[4-[(4-chloro-3-fluorophenyl)methyl]-6-methoxy-3,5-dioxo-1,2,4-triazin-2-yl]-2-fluorophenyl]acetamide |
| InChIKey | BQDMEJYNGXEHSW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)N2C(=O)N(C(=O)C(=N2)OC)CC3=CC(=C(C=C3)Cl)F)F |
Computed by PubChem (NCBI)