Products 120758-24-9

CAS 120758-24-9 is the registry number for Silodosin Impurity 60. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-methylbenzenesulfonic acid;3-phenylmethoxypropan-1-ol (CAS 120758-24-9) is a chemical compound with the molecular formula C17H22O5S and a molecular weight of 338.4 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;3-phenylmethoxypropan-1-ol. InChIKey: LINJDYBWHKUSNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22O5S
Molecular weight338.4 g/mol
IUPAC name4-methylbenzenesulfonic acid;3-phenylmethoxypropan-1-ol
InChIKeyLINJDYBWHKUSNQ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COCCCO

Computed by PubChem (NCBI)