CAS 1207604-30-5 is the registry number for Boc-L-Phe(3,5-(CF3)2)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg, 1g.
(2S)-3-[3,5-bis(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1207604-30-5) is a chemical compound with the molecular formula C16H17F6NO4 and a molecular weight of 401.30 g/mol. IUPAC name: (2S)-3-[3,5-bis(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: LMMRWUKBBWHZMM-NSHDSACASA-N.
| Molecular formula | C16H17F6NO4 |
|---|---|
| Molecular weight | 401.30 g/mol |
| IUPAC name | (2S)-3-[3,5-bis(trifluoromethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | LMMRWUKBBWHZMM-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)