Products 1207615-74-4

CAS 1207615-74-4 is the registry number for YTR107, 95.33%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 25 mg, 100 mg.

Structural formula: {0} (CAS {1})

4-[[3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile (CAS 1207615-74-4) is a chemical compound with the molecular formula C21H14N4O3 and a molecular weight of 370.4 g/mol. IUPAC name: 4-[[3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile. InChIKey: UGGIKHBVNATJPW-UHFFFAOYSA-N.

Identity
Molecular formulaC21H14N4O3
Molecular weight370.4 g/mol
IUPAC name4-[[3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile
InChIKeyUGGIKHBVNATJPW-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)C#N)C=C4C(=O)NC(=O)NC4=O

Computed by PubChem (NCBI)