Products 120786-18-7
CAS 120786-18-7 appears in our catalog under these names: (±)-Huperzine A, (+/-)-Huperzine A, (±)-Huperzine A/ 98.14% (existing batch purity), (±)–Huperzine A, (±)-Huperzine A, 98.73%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 5mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
1-amino-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (CAS 120786-18-7) is a chemical compound with the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. IUPAC name: 1-amino-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one. InChIKey: ZRJBHWIHUMBLCN-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O |
|---|---|
| Molecular weight | 242.32 g/mol |
| IUPAC name | 1-amino-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| InChIKey | ZRJBHWIHUMBLCN-UHFFFAOYSA-N |
| SMILES | CC=C1C2CC3=C(C1(CC(=C2)C)N)C=CC(=O)N3 |
Computed by PubChem (NCBI)