CAS 1207874-07-4 is the registry number for (1S,2S)–2–(2,5–Dimethyl–1H–pyrrol–1–yl)cyclohexanamine. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
Trans-(1S,2S)-2-(2,5-dimethylpyrrol-1-yl)cyclohexan-1-amine (CAS 1207874-07-4) is a chemical compound with the molecular formula C12H20N2 and a molecular weight of 192.30 g/mol. IUPAC name: trans-(1S,2S)-2-(2,5-dimethylpyrrol-1-yl)cyclohexan-1-amine. InChIKey: MVHWBCPGJWWEQG-RYUDHWBXSA-N.
| Molecular formula | C12H20N2 |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | trans-(1S,2S)-2-(2,5-dimethylpyrrol-1-yl)cyclohexan-1-amine |
| InChIKey | MVHWBCPGJWWEQG-RYUDHWBXSA-N |
| SMILES | CC1=CC=C(N1[C@H]2CCCC[C@@H]2N)C |
Computed by PubChem (NCBI)