CAS 120791-60-8 appears in our catalog under these names: 6-Amino-1,3,3-trimethyl-2-oxoindoline, 95%, 6-Amino-1,3,3-trimethylindolin-2-one, 97%, 6–amino–1,3,3–trimethyl–2,3–dihydro–1H–indol–2–one, 6-Amino-1,3,3-trimethylindolin-2-one, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 500mg.
6-amino-1,3,3-trimethylindol-2-one (CAS 120791-60-8) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 6-amino-1,3,3-trimethylindol-2-one. InChIKey: REGFWMJGPPJKKI-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 6-amino-1,3,3-trimethylindol-2-one |
| InChIKey | REGFWMJGPPJKKI-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)N)N(C1=O)C)C |
Computed by PubChem (NCBI)