CAS 1207945-97-8 is the registry number for 1,3,5-Tris(1H-benzo[d]imidazol-1-yl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3,5-bis(benzimidazol-1-yl)phenyl]benzimidazole (CAS 1207945-97-8) is a chemical compound with the molecular formula C27H18N6 and a molecular weight of 426.5 g/mol. IUPAC name: 1-[3,5-bis(benzimidazol-1-yl)phenyl]benzimidazole. InChIKey: CLVCDHXJYJXJOL-UHFFFAOYSA-N.
| Molecular formula | C27H18N6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 1-[3,5-bis(benzimidazol-1-yl)phenyl]benzimidazole |
| InChIKey | CLVCDHXJYJXJOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2C3=CC(=CC(=C3)N4C=NC5=CC=CC=C54)N6C=NC7=CC=CC=C76 |
Computed by PubChem (NCBI)