CAS 1207954-47-9 is the registry number for 2-Methyl-4-(4-(trifluoromethyl)benzyl)-4H-thieno[3,2-b]pyrrole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyrrole-3-carboxylic acid (CAS 1207954-47-9) is a chemical compound with the molecular formula C16H12F3NO2S and a molecular weight of 339.3 g/mol. IUPAC name: 2-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyrrole-3-carboxylic acid. InChIKey: IUQBWRCKKKCHAL-UHFFFAOYSA-N.
| Molecular formula | C16H12F3NO2S |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 2-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]thieno[3,2-b]pyrrole-3-carboxylic acid |
| InChIKey | IUQBWRCKKKCHAL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)C=CN2CC3=CC=C(C=C3)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)