CAS 1208076-07-6 is the registry number for 2-Bromo-1-[6-(4-fluoro-phenyl)-2-methyl-pyridin-3-yl]-ethanone. Offered by: Fluorochem. Available pack sizes: 1g.
2-bromo-1-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]ethanone;hydrobromide (CAS 1208076-07-6) is a chemical compound with the molecular formula C14H12Br2FNO and a molecular weight of 389.06 g/mol. IUPAC name: 2-bromo-1-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]ethanone;hydrobromide. InChIKey: GXABUSJKJPXVEF-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2FNO |
|---|---|
| Molecular weight | 389.06 g/mol |
| IUPAC name | 2-bromo-1-[6-(4-fluorophenyl)-2-methyl-3-pyridinyl]ethanone;hydrobromide |
| InChIKey | GXABUSJKJPXVEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C2=CC=C(C=C2)F)C(=O)CBr.Br |
Computed by PubChem (NCBI)