CAS 1208077-20-6 appears in our catalog under these names: 6-Chloro-2,3-difluorobenzenesulfonamide, 97%, 6-Chloro-2,3-difluorobenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-chloro-2,3-difluorobenzenesulfonamide (CAS 1208077-20-6) is a chemical compound with the molecular formula C6H4ClF2NO2S and a molecular weight of 227.62 g/mol. IUPAC name: 6-chloro-2,3-difluorobenzenesulfonamide. InChIKey: LSAZCHPZKNTWOE-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF2NO2S |
|---|---|
| Molecular weight | 227.62 g/mol |
| IUPAC name | 6-chloro-2,3-difluorobenzenesulfonamide |
| InChIKey | LSAZCHPZKNTWOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)