CAS 1208077-42-2 is the registry number for 2-Bromo-1-(2-methyl-6-phenyl-pyridin-3-yl)-ethanone. Offered by: Fluorochem. Available pack sizes: 1g.
2-bromo-1-(2-methyl-6-phenyl-3-pyridinyl)ethanone;hydrobromide (CAS 1208077-42-2) is a chemical compound with the molecular formula C14H13Br2NO and a molecular weight of 371.07 g/mol. IUPAC name: 2-bromo-1-(2-methyl-6-phenyl-3-pyridinyl)ethanone;hydrobromide. InChIKey: NGAJBSWDLLECJD-UHFFFAOYSA-N.
| Molecular formula | C14H13Br2NO |
|---|---|
| Molecular weight | 371.07 g/mol |
| IUPAC name | 2-bromo-1-(2-methyl-6-phenyl-3-pyridinyl)ethanone;hydrobromide |
| InChIKey | NGAJBSWDLLECJD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C2=CC=CC=C2)C(=O)CBr.Br |
Computed by PubChem (NCBI)