CAS 1208077-50-2 is the registry number for 2,2,2-Trifluoro-1-(2-fluoro-6-iodo-phenyl)-ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(2-fluoro-6-iodophenyl)ethanone (CAS 1208077-50-2) is a chemical compound with the molecular formula C8H3F4IO and a molecular weight of 318.01 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluoro-6-iodophenyl)ethanone. InChIKey: QTEGKEKPSMSVJS-UHFFFAOYSA-N.
| Molecular formula | C8H3F4IO |
|---|---|
| Molecular weight | 318.01 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluoro-6-iodophenyl)ethanone |
| InChIKey | QTEGKEKPSMSVJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)