Products 1208078-30-1

CAS 1208078-30-1 is the registry number for 2-Methyl-3,4-difluoroanisole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1,2-difluoro-4-methoxy-3-methylbenzene (CAS 1208078-30-1) is a chemical compound with the molecular formula C8H8F2O and a molecular weight of 158.14 g/mol. IUPAC name: 1,2-difluoro-4-methoxy-3-methylbenzene. InChIKey: OUDKTHHIIZJNMU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8F2O
Molecular weight158.14 g/mol
IUPAC name1,2-difluoro-4-methoxy-3-methylbenzene
InChIKeyOUDKTHHIIZJNMU-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1F)F)OC

Computed by PubChem (NCBI)