CAS 1208123-85-6 appears in our catalog under these names: CaMKII-IN-1, 98+%, CaMKII-IN-1/ 98.35% (existing batch purity), CaMKII Inhibitor XII 1PC X 10MG, CaMKII-IN-1, CaMKII-IN-1, 98.63%. Offered by: AmBeed, TargetMol, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 1mg, 2mg, 5mg, 10mg, 25mg.
N-[6-benzyl-2-(2-phenylethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-3-chloro-2-methylbenzenesulfonamide (CAS 1208123-85-6) is a chemical compound with the molecular formula C29H30ClN5O2S and a molecular weight of 548.1 g/mol. IUPAC name: N-[6-benzyl-2-(2-phenylethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-3-chloro-2-methylbenzenesulfonamide. InChIKey: LGUUETDTMQTHML-UHFFFAOYSA-N.
| Molecular formula | C29H30ClN5O2S |
|---|---|
| Molecular weight | 548.1 g/mol |
| IUPAC name | N-[6-benzyl-2-(2-phenylethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-3-chloro-2-methylbenzenesulfonamide |
| InChIKey | LGUUETDTMQTHML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)S(=O)(=O)NC2=NC(=NC3=C2CN(CC3)CC4=CC=CC=C4)NCCC5=CC=CC=C5 |
Computed by PubChem (NCBI)