Products 1208313-13-6
CAS 1208313-13-6 appears in our catalog under these names: Fesoterodine Impurity 19, O-Isobutyryl (R)-Fesoterodine, Fesoterodine Impurity 11. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[3-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)phenyl]methyl 2-methylpropanoate (CAS 1208313-13-6) is a chemical compound with the molecular formula C30H43NO4 and a molecular weight of 481.7 g/mol. IUPAC name: [3-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)phenyl]methyl 2-methylpropanoate. InChIKey: WXQIMMHESMEGJT-SANMLTNESA-N.
| Molecular formula | C30H43NO4 |
|---|---|
| Molecular weight | 481.7 g/mol |
| IUPAC name | [3-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)phenyl]methyl 2-methylpropanoate |
| InChIKey | WXQIMMHESMEGJT-SANMLTNESA-N |
| SMILES | CC(C)C(=O)OCC1=CC(=C(C=C1)OC(=O)C(C)C)[C@@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)