Products 120850-86-4
CAS 120850-86-4 is the registry number for (1S,2R,3S,4R)-3-(Dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2R,3S,4R)-3-(dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (CAS 120850-86-4) is a chemical compound with the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. IUPAC name: (1S,2R,3S,4R)-3-(dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol. InChIKey: ZDEYHASQASZDRQ-QFOLPQNPSA-N.
| Molecular formula | C12H23NO |
|---|---|
| Molecular weight | 197.32 g/mol |
| IUPAC name | (1S,2R,3S,4R)-3-(dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| InChIKey | ZDEYHASQASZDRQ-QFOLPQNPSA-N |
| SMILES | C[C@]12CC[C@H](C1(C)C)[C@@H]([C@@H]2O)N(C)C |
Computed by PubChem (NCBI)