CAS 103729-96-0 appears in our catalog under these names: (1R,2S,3R,4S)-3-(Dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol, 95+%, (2S)-3-exo-(Dimethylamino)isoborneol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(1R,2S,3R,4S)-3-(dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (CAS 103729-96-0) is a chemical compound with the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. IUPAC name: (1R,2S,3R,4S)-3-(dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol. InChIKey: ZDEYHASQASZDRQ-BFLSOPEQSA-N.
| Molecular formula | C12H23NO |
|---|---|
| Molecular weight | 197.32 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-(dimethylamino)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| InChIKey | ZDEYHASQASZDRQ-BFLSOPEQSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)[C@H]([C@H]2O)N(C)C |
Computed by PubChem (NCBI)