CAS 1208696-98-3 appears in our catalog under these names: 1,3-Bis(1,3-dimethyl-1h-pyrazol-5-yl)urea, 95%, 1,3-Bis(1,3-dimethyl-1H-pyrazol-5-yl)urea. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,3-bis(2,5-dimethylpyrazol-3-yl)urea (CAS 1208696-98-3) is a chemical compound with the molecular formula C11H16N6O and a molecular weight of 248.28 g/mol. IUPAC name: 1,3-bis(2,5-dimethylpyrazol-3-yl)urea. InChIKey: YKPQIDOCNCFFFW-UHFFFAOYSA-N.
| Molecular formula | C11H16N6O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1,3-bis(2,5-dimethylpyrazol-3-yl)urea |
| InChIKey | YKPQIDOCNCFFFW-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NC(=O)NC2=CC(=NN2C)C)C |
Computed by PubChem (NCBI)