CAS 1208824-92-3 is the registry number for N-((3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl)methyl)-2-methylpropan-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylpropan-2-amine (CAS 1208824-92-3) is a chemical compound with the molecular formula C13H16FN3O and a molecular weight of 249.28 g/mol. IUPAC name: N-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylpropan-2-amine. InChIKey: DCEYTYMDVFZGKW-UHFFFAOYSA-N.
| Molecular formula | C13H16FN3O |
|---|---|
| Molecular weight | 249.28 g/mol |
| IUPAC name | N-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methylpropan-2-amine |
| InChIKey | DCEYTYMDVFZGKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC1=NC(=NO1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)