CAS 1208849-38-0 appears in our catalog under these names: 3-(Piperidin-1-ylmethyl)benzene-1-carboximidamide dihydrochloride, 95%, 3-(Piperidin-1-ylmethyl)benzene-1-carboximidamide dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(piperidin-1-ylmethyl)benzenecarboximidamide;dihydrochloride (CAS 1208849-38-0) is a chemical compound with the molecular formula C13H21Cl2N3 and a molecular weight of 290.23 g/mol. IUPAC name: 3-(piperidin-1-ylmethyl)benzenecarboximidamide;dihydrochloride. InChIKey: ZIBNEFLVVJZXJN-UHFFFAOYSA-N.
| Molecular formula | C13H21Cl2N3 |
|---|---|
| Molecular weight | 290.23 g/mol |
| IUPAC name | 3-(piperidin-1-ylmethyl)benzenecarboximidamide;dihydrochloride |
| InChIKey | ZIBNEFLVVJZXJN-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=CC(=CC=C2)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)