Products 1208903-74-5

CAS 1208903-74-5 is the registry number for Gefitinib Impurity 47. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-amino-5-hydroxy-4-methoxybenzonitrile (CAS 1208903-74-5) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: 2-amino-5-hydroxy-4-methoxybenzonitrile. InChIKey: WNFXPERGWUGQHN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O2
Molecular weight164.16 g/mol
IUPAC name2-amino-5-hydroxy-4-methoxybenzonitrile
InChIKeyWNFXPERGWUGQHN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)N)C#N)O

Computed by PubChem (NCBI)