CAS 120924-80-3 is the registry number for SCH 39304. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R)-2-(2,4-difluorophenyl)-3-methylsulfonyl-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 120924-80-3) is a chemical compound with the molecular formula C13H15F2N3O3S and a molecular weight of 331.34 g/mol. IUPAC name: (2R,3R)-2-(2,4-difluorophenyl)-3-methylsulfonyl-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: HFGZFHCWKKQGIS-NOZJJQNGSA-N.
| Molecular formula | C13H15F2N3O3S |
|---|---|
| Molecular weight | 331.34 g/mol |
| IUPAC name | (2R,3R)-2-(2,4-difluorophenyl)-3-methylsulfonyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | HFGZFHCWKKQGIS-NOZJJQNGSA-N |
| SMILES | C[C@H]([C@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)O)S(=O)(=O)C |
Computed by PubChem (NCBI)