Products 1209335-53-4

CAS 1209335-53-4 is the registry number for 4-Bromo-3-methoxypyridine hydrochloride, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-bromo-3-methoxypyridine;hydrochloride (CAS 1209335-53-4) is a chemical compound with the molecular formula C6H7BrClNO and a molecular weight of 224.48 g/mol. IUPAC name: 4-bromo-3-methoxypyridine;hydrochloride. InChIKey: RMMARTLPJIOTDK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BrClNO
Molecular weight224.48 g/mol
IUPAC name4-bromo-3-methoxypyridine;hydrochloride
InChIKeyRMMARTLPJIOTDK-UHFFFAOYSA-N
SMILESCOC1=C(C=CN=C1)Br.Cl

Computed by PubChem (NCBI)