Products 120935-94-6
CAS 120935-94-6 is the registry number for Methyl 4-bromo-2,5-dimethyl-1h-pyrrole-3-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate (CAS 120935-94-6) is a chemical compound with the molecular formula C8H10BrNO2 and a molecular weight of 232.07 g/mol. IUPAC name: methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate. InChIKey: LGBDYFSMZPRVLL-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2 |
|---|---|
| Molecular weight | 232.07 g/mol |
| IUPAC name | methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| InChIKey | LGBDYFSMZPRVLL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N1)C)Br)C(=O)OC |
Computed by PubChem (NCBI)