CAS 120943-07-9 appears in our catalog under these names: Fmoc-Pro-Phe-OH, Fmoc–Pro–Phe–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 5g, 5000mg, 2000mg, 10000mg.
(2S)-2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid (CAS 120943-07-9) is a chemical compound with the molecular formula C29H28N2O5 and a molecular weight of 484.5 g/mol. IUPAC name: (2S)-2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid. InChIKey: ZLLLIQSZNKOVSQ-UIOOFZCWSA-N.
| Molecular formula | C29H28N2O5 |
|---|---|
| Molecular weight | 484.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
| InChIKey | ZLLLIQSZNKOVSQ-UIOOFZCWSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)N[C@@H](CC5=CC=CC=C5)C(=O)O |
Computed by PubChem (NCBI)