CAS 1209778-49-3 is the registry number for (11E)-Tetradecen-1-yl-d5 Acetate. Offered by: TRC. Available pack sizes: 250mg.
[(E)-13,13,14,14,14-pentadeuteriotetradec-11-enyl] acetate (CAS 1209778-49-3) is a chemical compound with the molecular formula C16H30O2 and a molecular weight of 259.44 g/mol. IUPAC name: [(E)-13,13,14,14,14-pentadeuteriotetradec-11-enyl] acetate. InChIKey: YJINQJFQLQIYHX-SMJXTGSFSA-N.
| Molecular formula | C16H30O2 |
|---|---|
| Molecular weight | 259.44 g/mol |
| IUPAC name | [(E)-13,13,14,14,14-pentadeuteriotetradec-11-enyl] acetate |
| InChIKey | YJINQJFQLQIYHX-SMJXTGSFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C=C/CCCCCCCCCCOC(=O)C |
Computed by PubChem (NCBI)