CAS 1209807-12-4 appears in our catalog under these names: 5-((2,4-Difluorophenyl)methyl)-1,3-thiazol-2-amine hydrochloride, 95%, 5-((2,4-Difluorophenyl)methyl)-1,3-thiazol-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-amine;hydrochloride (CAS 1209807-12-4) is a chemical compound with the molecular formula C10H9ClF2N2S and a molecular weight of 262.71 g/mol. IUPAC name: 5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-amine;hydrochloride. InChIKey: MPIQVTCIQVUAGM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2N2S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | 5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | MPIQVTCIQVUAGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC2=CN=C(S2)N.Cl |
Computed by PubChem (NCBI)