CAS 121-87-9 appears in our catalog under these names: 2-Chloro-4-nitroaniline, 95%, 2-Chloro-4-nitroaniline, 2-Chloro-4-nitroaniline, 98+% , 2-Chloro-4-nitroaniline, >98.0%(GC), 2-CHLORO-4-NITROANILINE, 99%. Offered by: Combi-blocks, Dr. Ehrenstorfer, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 1kg, 100g, 500g, 25g, 5g, 500mg, 1000g, 5000g.
2-chloro-4-nitroaniline (CAS 121-87-9) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 2-chloro-4-nitroaniline. InChIKey: LOCWBQIWHWIRGN-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 2-chloro-4-nitroaniline |
| InChIKey | LOCWBQIWHWIRGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)N |
Computed by PubChem (NCBI)