CAS 1210004-12-8 appears in our catalog under these names: JZL 195, JZL195/ 99.78% (existing batch purity), JZL 195, JZL 195, 98%, 98%, JZL195, 99.75%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 10mg, 25mg, 100mg, 200mg, 250mg, 10mM/1mL, 5 mg.
(4-nitrophenyl) 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate (CAS 1210004-12-8) is a chemical compound with the molecular formula C24H23N3O5 and a molecular weight of 433.5 g/mol. IUPAC name: (4-nitrophenyl) 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate. InChIKey: QNYRAEKLMNDRFY-UHFFFAOYSA-N.
| Molecular formula | C24H23N3O5 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | (4-nitrophenyl) 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate |
| InChIKey | QNYRAEKLMNDRFY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC(=CC=C2)OC3=CC=CC=C3)C(=O)OC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)