CAS 1210048-06-8 is the registry number for 5-Fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg.
5-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline (CAS 1210048-06-8) is a chemical compound with the molecular formula C14H16BFN2O2 and a molecular weight of 274.10 g/mol. IUPAC name: 5-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline. InChIKey: CXBUYZOYDARROU-UHFFFAOYSA-N.
| Molecular formula | C14H16BFN2O2 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | 5-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
| InChIKey | CXBUYZOYDARROU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NC=CN=C3C(=C2)F |
Computed by PubChem (NCBI)