CAS 1210126-98-9 is the registry number for 2-(((5-Chloro-1,2,3-thiadiazol-4-yl)methyl)(cyclopentyl)amino)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-chlorothiadiazol-4-yl)methyl-cyclopentylamino]acetamide (CAS 1210126-98-9) is a chemical compound with the molecular formula C10H15ClN4OS and a molecular weight of 274.77 g/mol. IUPAC name: 2-[(5-chlorothiadiazol-4-yl)methyl-cyclopentylamino]acetamide. InChIKey: LBTLHBPCDVVXNB-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN4OS |
|---|---|
| Molecular weight | 274.77 g/mol |
| IUPAC name | 2-[(5-chlorothiadiazol-4-yl)methyl-cyclopentylamino]acetamide |
| InChIKey | LBTLHBPCDVVXNB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N(CC2=C(SN=N2)Cl)CC(=O)N |
Computed by PubChem (NCBI)