CAS 1210160-78-3 appears in our catalog under these names: 2-Chloro-N-(1-(thiophen-2-ylmethyl)-1H-pyrazol-5-yl)acetamide, 95%, 2-Chloro-N-(1-(thiophen-2-ylmethyl)-1H-pyrazol-5-yl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]acetamide (CAS 1210160-78-3) is a chemical compound with the molecular formula C10H10ClN3OS and a molecular weight of 255.72 g/mol. IUPAC name: 2-chloro-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]acetamide. InChIKey: LXWNTYQLBOQPGL-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3OS |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | 2-chloro-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]acetamide |
| InChIKey | LXWNTYQLBOQPGL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CN2C(=CC=N2)NC(=O)CCl |
Computed by PubChem (NCBI)