CAS 1210330-64-5 appears in our catalog under these names: Lesinurad Impurity E, Lesinurad Impurity 9 (Lesinurad Impurity E), Lesinurad Impurity 6, 2-((5-Bromo-4-(naphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)-acetic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(5-bromo-4-naphthalen-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (CAS 1210330-64-5) is a chemical compound with the molecular formula C14H10BrN3O2S and a molecular weight of 364.22 g/mol. IUPAC name: 2-[(5-bromo-4-naphthalen-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid. InChIKey: FYTUXVMZGZEASH-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3O2S |
|---|---|
| Molecular weight | 364.22 g/mol |
| IUPAC name | 2-[(5-bromo-4-naphthalen-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| InChIKey | FYTUXVMZGZEASH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C(=NN=C3Br)SCC(=O)O |
Computed by PubChem (NCBI)