Products 1210418-88-4

CAS 1210418-88-4 is the registry number for 5-Fluoro-6-(2-fluoro-5-propoxyphenyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-fluoro-6-(2-fluoro-5-propoxyphenyl)pyridine-2-carboxylic acid (CAS 1210418-88-4) is a chemical compound with the molecular formula C15H13F2NO3 and a molecular weight of 293.26 g/mol. IUPAC name: 5-fluoro-6-(2-fluoro-5-propoxyphenyl)pyridine-2-carboxylic acid. InChIKey: NOHABLGVPAYXPH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13F2NO3
Molecular weight293.26 g/mol
IUPAC name5-fluoro-6-(2-fluoro-5-propoxyphenyl)pyridine-2-carboxylic acid
InChIKeyNOHABLGVPAYXPH-UHFFFAOYSA-N
SMILESCCCOC1=CC(=C(C=C1)F)C2=C(C=CC(=N2)C(=O)O)F

Computed by PubChem (NCBI)