CAS 1210419-21-8 is the registry number for 6-(2,6-Difluorophenyl)-3-fluoropicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2,6-difluorophenyl)-3-fluoropyridine-2-carboxylic acid (CAS 1210419-21-8) is a chemical compound with the molecular formula C12H6F3NO2 and a molecular weight of 253.18 g/mol. IUPAC name: 6-(2,6-difluorophenyl)-3-fluoropyridine-2-carboxylic acid. InChIKey: JXEOZNPRYKTKOQ-UHFFFAOYSA-N.
| Molecular formula | C12H6F3NO2 |
|---|---|
| Molecular weight | 253.18 g/mol |
| IUPAC name | 6-(2,6-difluorophenyl)-3-fluoropyridine-2-carboxylic acid |
| InChIKey | JXEOZNPRYKTKOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NC(=C(C=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)