CAS 1210538-56-9 appears in our catalog under these names: RU-TRAAK-2/ 99.68% (existing batch purity), RU–TRAAK–2, 1-(Benzo[d]thiazol-2-ylmethyl)-1-methyl-3-(3-phenylprop-2-yn-1-yl)urea, 99%, 99%, RU-TRAAK-2, 99.53%, RU-TRAAK-2, 99%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 10mM/1mL.
1-(1,3-benzothiazol-2-ylmethyl)-1-methyl-3-(3-phenylprop-2-ynyl)urea (CAS 1210538-56-9) is a chemical compound with the molecular formula C19H17N3OS and a molecular weight of 335.4 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-ylmethyl)-1-methyl-3-(3-phenylprop-2-ynyl)urea. InChIKey: YIQVUMDINCCARL-UHFFFAOYSA-N.
| Molecular formula | C19H17N3OS |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-ylmethyl)-1-methyl-3-(3-phenylprop-2-ynyl)urea |
| InChIKey | YIQVUMDINCCARL-UHFFFAOYSA-N |
| SMILES | CN(CC1=NC2=CC=CC=C2S1)C(=O)NCC#CC3=CC=CC=C3 |
Computed by PubChem (NCBI)