CAS 121055-53-6 appears in our catalog under these names: N2,3-Etheno-2'-deoxy Guanosine, 2'-Deoxy-N2,3-ethenoguanosine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg.
1-[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-imidazo[2,1-b]purin-4-one (CAS 121055-53-6) is a chemical compound with the molecular formula C12H13N5O4 and a molecular weight of 291.26 g/mol. IUPAC name: 1-[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-imidazo[2,1-b]purin-4-one. InChIKey: DUHWHZGZQYBCAZ-KJFJCRTCSA-N.
| Molecular formula | C12H13N5O4 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | 1-[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-imidazo[2,1-b]purin-4-one |
| InChIKey | DUHWHZGZQYBCAZ-KJFJCRTCSA-N |
| SMILES | C1[C@@H]([C@H](OC1N2C=NC3=C2N4C=CN=C4NC3=O)CO)O |
Computed by PubChem (NCBI)