Products 121071-92-9
CAS 121071-92-9 is the registry number for Opc-15161. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(1H-indol-3-ylmethyl)-5-methoxy-3-(2-methylpropyl)-4-oxido-1H-pyrazin-4-ium-2-one (CAS 121071-92-9) is a chemical compound with the molecular formula C18H21N3O3 and a molecular weight of 327.4 g/mol. IUPAC name: 6-(1H-indol-3-ylmethyl)-5-methoxy-3-(2-methylpropyl)-4-oxido-1H-pyrazin-4-ium-2-one. InChIKey: AFTLYEDBVFGRNK-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 6-(1H-indol-3-ylmethyl)-5-methoxy-3-(2-methylpropyl)-4-oxido-1H-pyrazin-4-ium-2-one |
| InChIKey | AFTLYEDBVFGRNK-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=[N+](C(=C(NC1=O)CC2=CNC3=CC=CC=C32)OC)[O-] |
Computed by PubChem (NCBI)